CAS 878197-91-2

2-(Dichloromethyl)-5-fluoroimidazo[1,2-a]pyridine

Description:

2-(Dichloromethyl)-5-fluoroimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its imidazo[1,2-a]pyridine core, which incorporates both nitrogen and carbon atoms in its ring structure. This compound features a dichloromethyl group and a fluorine atom, contributing to its unique reactivity and potential biological activity. The presence of halogen substituents, such as chlorine and fluorine, often enhances the lipophilicity and metabolic stability of the compound, making it of interest in medicinal chemistry. Its structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. The compound's molecular properties, such as solubility, boiling point, and reactivity, are influenced by the functional groups attached to the imidazo[1,2-a]pyridine framework. As with many heterocycles, it may exhibit interesting electronic properties and could serve as a scaffold for further chemical modifications. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.

Formula: C₈H₅Cl₂FN₂

InChI: InChI=1S/C8H5Cl2FN2/c9-8(10)5-4-13-6(11)2-1-3-7(13)12-5/h1-4,8H

InChI key: InChIKey=YCOFITAQIPULIF-UHFFFAOYSA-N

SMILES: FC=1N2C(=NC(C(Cl)Cl)=C2)C=CC1

Synonyms:

• Imidazo[1,2-a]pyridine, 2-(dichloromethyl)-5-fluoro-
• 2-(Dichloromethyl)-5-fluoroimidazo[1,2-a]pyridine

Imidazo[1,2-a]pyridine, 2-(dichloromethyl)-5-fluoro-

CAS: 878197-91-2

Formula: C₈H₅Cl₂FN₂

Molecular weight: 219.0431

Ref: IN-DA004EOO