CAS 878200-22-7
:Pyridine, 3-[(4-fluorophenyl)methoxy]-4-nitro-, 1-oxide
Description:
Pyridine, 3-[(4-fluorophenyl)methoxy]-4-nitro-, 1-oxide, identified by its CAS number 878200-22-7, is a heterocyclic organic compound featuring a pyridine ring substituted with various functional groups. The presence of a nitro group and a methoxy group attached to the pyridine ring contributes to its chemical reactivity and potential applications in organic synthesis and medicinal chemistry. The fluorophenyl moiety enhances the compound's lipophilicity and may influence its biological activity. As a nitrogen-containing heterocycle, it exhibits basic properties, allowing it to participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. The compound's structural features suggest potential uses in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the presence of the nitro group may impart specific electronic properties, making it a candidate for further studies in materials science or as a dye. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds and the reactivity of the pyridine ring.
Formula:C12H9FN2O4
InChI:InChI=1S/C12H9FN2O4/c13-10-3-1-9(2-4-10)8-19-12-7-14(16)6-5-11(12)15(17)18/h1-7H,8H2
InChI key:InChIKey=OMSSSGZAMVWIDC-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(F)C=C1)C=2C(N(=O)=O)=CC=N(=O)C2
Synonyms:- 3-[(4-Fluorobenzyl)oxy]-4-nitropyridine N-oxide
- Pyridine, 3-[(4-fluorophenyl)methoxy]-4-nitro-, 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pyridine, 3-[(4-fluorophenyl)methoxy]-4-nitro-, 1-oxide
CAS:Formula:C12H9FN2O4Molecular weight:264.2093
