CymitQuimica logo

CAS 878208-79-8

:

4-(2-Aminoethyl)-1,2-dihydro-5-(4-methoxyphenyl)-3H-pyrazol-3-one

Description:
4-(2-Aminoethyl)-1,2-dihydro-5-(4-methoxyphenyl)-3H-pyrazol-3-one, with the CAS number 878208-79-8, is a chemical compound characterized by its pyrazolone structure, which features a five-membered ring containing two nitrogen atoms. This compound exhibits a range of functional groups, including an aminoethyl side chain and a methoxyphenyl substituent, which contribute to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and can act as a nucleophile in various chemical reactions. The methoxy group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could be linked to various pharmacological properties. Additionally, its unique arrangement of atoms may allow for interactions with specific biological targets, making it a candidate for further research in drug development or therapeutic applications.
Formula:C12H15N3O2
InChI:InChI=1S/C12H15N3O2/c1-17-9-4-2-8(3-5-9)11-10(6-7-13)12(16)15-14-11/h2-5H,6-7,13H2,1H3,(H2,14,15,16)
InChI key:InChIKey=OWNQZTXAACUVES-UHFFFAOYSA-N
SMILES:C(CN)C1=C(NNC1=O)C2=CC=C(OC)C=C2
Synonyms:
  • 3H-Pyrazol-3-one, 4-(2-aminoethyl)-1,2-dihydro-5-(4-methoxyphenyl)-
  • 4-(2-Aminoethyl)-1,2-dihydro-5-(4-methoxyphenyl)-3H-pyrazol-3-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.