CAS 87827-01-8
:N,N,N-Trimethyl-4-oxo-1-pentanaminium
Description:
N,N,N-Trimethyl-4-oxo-1-pentanaminium, with the CAS number 87827-01-8, is a quaternary ammonium compound characterized by its cationic nature due to the presence of a positively charged nitrogen atom. This compound features a pentanamide backbone with a ketone functional group at the fourth carbon position, contributing to its reactivity and potential applications. It is typically soluble in polar solvents, which enhances its utility in various chemical processes, including as a surfactant or in formulations requiring antimicrobial properties. The trimethyl groups attached to the nitrogen atom increase the steric hindrance, influencing its interaction with biological membranes and other substances. This compound may exhibit properties such as antimicrobial activity, making it of interest in pharmaceutical and industrial applications. However, specific handling precautions should be observed due to its cationic nature, which can lead to interactions with anionic substances. Overall, N,N,N-Trimethyl-4-oxo-1-pentanaminium is a versatile compound with potential applications in various fields, including biochemistry and materials science.
Formula:C8H18NO
InChI:InChI=1/C8H18NO/c1-8(10)6-5-7-9(2,3)4/h5-7H2,1-4H3/q+1
InChI key:InChIKey=UKCYTFTWLWVZSO-UHFFFAOYSA-N
SMILES:C(CCC(C)=O)[N+](C)(C)C
Synonyms:- 1-pentanaminium, N,N,N-trimethyl-4-oxo-
- 5-(Trimethylammonio)-2-pentanone
- 1-Pentanaminium, N,N,N-trimethyl-4-oxo-
- 4-KETOAMYLTRIMETHYLAMMONIUM
- N,N,N-Trimethyl-4-oxopentan-1-aminium
- Ammonium, trimethyl(4-oxopentyl)-
- N,N,N-Trimethyl-4-oxo-1-pentanaminium
- 5-Trimethylammonio-2-pentanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
