CAS 87829-34-3

2,4(1H,3H)-Pyridinedione,3-(aminophenylmethylene)-1-methyl-6-phenyl-, (E)-

Description:

2,4(1H,3H)-Pyridinedione, 3-(aminophenylmethylene)-1-methyl-6-phenyl-, (E)-, with CAS number 87829-34-3, is an organic compound characterized by its complex structure that includes a pyridine ring and multiple functional groups. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the aminophenylmethylene group suggests it may participate in hydrogen bonding and exhibit polar characteristics, which can influence its solubility in different solvents. The (E)- configuration indicates a specific geometric arrangement around the double bond, which can affect its reactivity and interaction with biological systems. This compound may have applications in pharmaceuticals or as a chemical intermediate due to its unique structural features. Additionally, its potential biological activity could be explored in medicinal chemistry, although specific biological properties would require further investigation. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₉H₁₆N₂O₂

InChI: InChI=1S/C19H16N2O2/c1-21-15(13-8-4-2-5-9-13)12-16(22)17(19(21)23)18(20)14-10-6-3-7-11-14/h2-12,20,22H,1H3

InChI key: WZKXUAOTZXJBRD-UHFFFAOYSA-N

SMILES: CN1C(=CC(=C(C1=O)C(=N)C2=CC=CC=C2)O)C3=CC=CC=C3