
CAS 87831-99-0
:5-Methyl-1,3-dioxan-2-one
Description:
5-Methyl-1,3-dioxan-2-one, with the CAS number 87831-99-0, is a cyclic organic compound characterized by its dioxan ring structure, which contains two oxygen atoms and a carbonyl group. This compound features a methyl group at the 5-position, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the dioxan ring imparts certain stability and reactivity characteristics, making it useful in various chemical syntheses. It is soluble in organic solvents and may exhibit moderate polarity due to the functional groups present. The compound is of interest in organic chemistry and may serve as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential health and environmental impacts.
Formula:C5H8O3
InChI:InChI=1S/C5H8O3/c1-4-2-7-5(6)8-3-4/h4H,2-3H2,1H3
InChI key:InChIKey=FIURNUKOIGKIJB-UHFFFAOYSA-N
SMILES:CC1COC(=O)OC1
Synonyms:- 1,3-Dioxan-2-one, 5-methyl-
- 5-Methyl-1,3-dioxan-2-one
- 2-Methyl-1,3-propylene carbonate
- Cyclic 2-methylpropane carbonate
- 2-Methyl-1,3-propanediol carbonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
