CAS 87833-54-3
:6-Deoxocastasterone
Description:
6-Deoxocastasterone is a plant hormone belonging to the brassinosteroid class, which plays a crucial role in various physiological processes in plants, including growth, development, and stress responses. It is characterized by its steroidal structure, which is essential for its biological activity. This compound is known for its ability to promote cell elongation, enhance seed germination, and improve stress tolerance in plants. 6-Deoxocastasterone is typically synthesized in the plant tissues and can be found in various plant species. Its activity is mediated through specific receptors that trigger signaling pathways, leading to physiological changes. The compound is also of interest in agricultural research for its potential applications in crop improvement and yield enhancement. As a chemical entity, it has a specific molecular formula and weight, and its stability and reactivity can be influenced by environmental conditions. Overall, 6-Deoxocastasterone is a significant substance in plant biology, contributing to our understanding of plant growth regulation and development.
Formula:C28H50O4
InChI:InChI=1S/C28H50O4/c1-15(2)16(3)25(31)26(32)17(4)20-9-10-21-19-8-7-18-13-23(29)24(30)14-28(18,6)22(19)11-12-27(20,21)5/h15-26,29-32H,7-14H2,1-6H3/t16-,17-,18-,19-,20+,21-,22-,23-,24+,25+,26+,27+,28-/m0/s1
InChI key:InChIKey=VXBLCLVRWCLEOX-BFYSZXNBSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)[C@@](CC3)(C[C@H](O)[C@H](O)C4)[H])(CC1)[H])[H])(CC[C@@]2([C@@H]([C@H]([C@@H]([C@H](C(C)C)C)O)O)C)[H])[H]
Synonyms:- (2α,3α,5α,22R,23R,24S)-Ergostane-2,3,22,23-tetrol
- Ergostane-2,3,22,23-tetrol, (2α,3α,5α,22R,23R,24S)-
- 6-Deoxocastasterone
- (22R,23R,24S)-5α-Ergostane-2α,3α,22,23-tetraol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
6-Deoxocastasterone
CAS:Controlled ProductFormula:C28H50O4Color and Shape:NeatMolecular weight:450.6946-Deoxocastasterone
CAS:Controlled Product6-Deoxocastasterone is an analog that has been found to have potential medicinal properties for the treatment of cancer. It acts as a protein kinase inhibitor, which can induce apoptosis in cancer cells and inhibit tumor growth. This compound has shown promising results in Chinese hamster ovary cells and human urine carcinoma cell lines. It has also been found to be effective in inhibiting the cell cycle progression of cancer cells, making it a potential candidate for anticancer therapy. With its potent anticancer properties, 6-Deoxocastasterone is a promising candidate for further study as a potential cancer treatment.Formula:C28H50O4Purity:Min. 95%Color and Shape:PowderMolecular weight:450.7 g/mol

