CymitQuimica logo

CAS 878376-82-0

:

tert-butyl 5-methylspiro[indoline-3,4'-piperidine]-1-carboxylate

Description:
Tert-butyl 5-methylspiro[indoline-3,4'-piperidine]-1-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which combines an indoline and a piperidine moiety. This compound typically features a tert-butyl ester functional group, contributing to its solubility and stability. The presence of the spiro linkage imparts distinct stereochemical properties, which can influence its reactivity and biological activity. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of the carboxylate group may facilitate further chemical modifications, enhancing its utility in synthetic chemistry. Overall, tert-butyl 5-methylspiro[indoline-3,4'-piperidine]-1-carboxylate is a versatile compound with potential applications in drug development and organic synthesis, although specific biological activities and reactivity would require further investigation.
Formula:C18H26N2O2
InChI:InChI=1/C18H26N2O2/c1-13-5-6-15-14(11-13)18(7-9-19-10-8-18)12-20(15)16(21)22-17(2,3)4/h5-6,11,19H,7-10,12H2,1-4H3
SMILES:Cc1ccc2c(c1)C1(CCNCC1)CN2C(=O)OC(C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.