CAS 87838-57-1

[1,2,3]Triazolo[1,5-a]pyridine-3-carbonyl chloride

Description:

[1,2,3]Triazolo[1,5-a]pyridine-3-carbonyl chloride is a heterocyclic compound characterized by the presence of a triazole ring fused to a pyridine structure, specifically at the 1,5 positions. This compound features a carbonyl chloride functional group, which is known for its reactivity, particularly in acylation reactions. The presence of the triazole moiety contributes to its potential biological activity, as triazoles are often found in pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity as an acyl chloride makes it useful in synthetic organic chemistry, particularly for the introduction of acyl groups into various substrates. Additionally, the unique structural features of this compound may impart specific electronic properties, influencing its interactions in chemical reactions. Safety precautions should be taken when handling this compound due to the potential hazards associated with carbonyl chlorides, including toxicity and corrosiveness.

Formula: C₇H₄ClN₃O

InChI: InChI=1S/C7H4ClN3O/c8-7(12)6-5-3-1-2-4-11(5)10-9-6/h1-4H

InChI key: InChIKey=CVPXSOSVLWVNSY-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C1=C2N(N=N1)C=CC=C2

Synonyms:

• [1,2,3]Triazolo[1,5-a]pyridine-3-carbonyl chloride

[1,2,3]Triazolo[1,5-a]pyridine-3-carbonylchloride

CAS: 87838-57-1

Formula: C₇H₄ClN₃O

Molecular weight: 181.5792

Ref: IN-DA004ENI