CymitQuimica logo

CAS 878384-70-4

:

B-[(1E,3E)-4-(Trimethylsilyl)-1,3-butadien-1-yl]boronic acid

Description:
B-[(1E,3E)-4-(Trimethylsilyl)-1,3-butadien-1-yl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a butadiene moiety that is substituted with a trimethylsilyl group, enhancing its stability and reactivity in various chemical reactions, particularly in cross-coupling reactions such as Suzuki coupling. The presence of the boronic acid group allows for the formation of boronate esters, making it useful in organic synthesis and materials science. Additionally, the trimethylsilyl group can provide steric hindrance, influencing the reactivity and selectivity of the compound in synthetic applications. Overall, this compound is valuable in the development of complex organic molecules and has potential applications in pharmaceuticals and agrochemicals. Its unique structural features contribute to its utility in various chemical transformations.
Formula:C7H15BO2Si
InChI:InChI=1S/C7H15BO2Si/c1-11(2,3)7-5-4-6-8(9)10/h4-7,9-10H,1-3H3/b6-4+,7-5+
InChI key:InChIKey=BHVPIFRCQYQWRK-YDFGWWAZSA-N
SMILES:C(\C=C\B(O)O)=C/[Si](C)(C)C
Synonyms:
  • Boronic acid, B-[(1E,3E)-4-(trimethylsilyl)-1,3-butadien-1-yl]-
  • B-[(1E,3E)-4-(Trimethylsilyl)-1,3-butadien-1-yl]boronic acid
  • Boronic acid, [(1E,3E)-4-(trimethylsilyl)-1,3-butadienyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.