CAS 87841-08-5

3-Bromo-1,2,4-triazolo[4,3-b]pyridazine

Description:

3-Bromo-1,2,4-triazolo[4,3-b]pyridazine is a heterocyclic compound characterized by its unique triazole and pyridazine ring structures. This compound features a bromine atom at the 3-position of the triazole ring, which can influence its reactivity and biological activity. The presence of both nitrogen and carbon atoms in its structure contributes to its potential as a ligand in coordination chemistry and as a scaffold in medicinal chemistry. It is typically a crystalline solid at room temperature and may exhibit moderate solubility in polar organic solvents. The compound's properties, such as melting point, boiling point, and spectral characteristics (like NMR and IR), can vary based on its purity and the conditions under which it is synthesized. 3-Bromo-1,2,4-triazolo[4,3-b]pyridazine is of interest in various fields, including pharmaceuticals, due to its potential biological activities, which may include antimicrobial or anticancer properties. As with many chemical substances, handling should be done with care, adhering to safety protocols to mitigate any risks associated with its use.

Formula: C₅H₃BrN₄

InChI: InChI=1S/C5H3BrN4/c6-5-9-8-4-2-1-3-7-10(4)5/h1-3H

InChI key: InChIKey=KWJBSUJSIKXPKX-UHFFFAOYSA-N

SMILES: BrC=1N2C(C=CC=N2)=NN1

3-Bromo-[1,2,4]triazolo[4,3-b]pyridazine

CAS: 87841-08-5

Versatile small molecule scaffold

Formula: C₅H₃BrN₄

Purity: Min. 95%

Molecular weight: 199.01 g/mol

Ref: 3D-MDA84108