CymitQuimica logo

CAS 878419-78-4

:

Walrycin B

Description:
Walrycin B is a chemical compound classified as a natural product, specifically a type of polyketide. It is known for its complex structure, which includes multiple functional groups that contribute to its biological activity. This compound has garnered attention in the field of medicinal chemistry due to its potential therapeutic properties, particularly in the context of antimicrobial and anticancer activities. Walrycin B exhibits a unique mechanism of action, which may involve the inhibition of specific enzymes or pathways within target cells. Its molecular structure typically features a series of rings and substituents that enhance its interaction with biological targets. As a compound with a specific CAS number, 878419-78-4, it can be identified and referenced in chemical databases, facilitating research and development efforts. Overall, Walrycin B represents a significant area of interest for researchers exploring novel drug candidates derived from natural sources.
Formula:C14H10F3N5O2
InChI:InChI=1S/C14H10F3N5O2/c1-21-12(23)9-11(19-13(21)24)22(2)20-10(18-9)7-3-5-8(6-4-7)14(15,16)17/h3-6H,1-2H3
InChI key:XRVMPTWWKLKLPB-UHFFFAOYSA-N
SMILES:CN1C2=NC(=O)N(C(=O)C2=NC(=N1)C3=CC=C(C=C3)C(F)(F)F)C
Found 5 products.