CAS 878427-52-2

N-[(5-formylfuran-2-yl)methyl]-N-methylmethanesulfonamide

Description:

N-[(5-formylfuran-2-yl)methyl]-N-methylmethanesulfonamide is a chemical compound characterized by its unique structure, which includes a furan ring with a formyl group and a sulfonamide functional group. The presence of the furan moiety contributes to its potential reactivity and biological activity, as furan derivatives are often involved in various chemical reactions and have applications in medicinal chemistry. The sulfonamide group enhances the compound's solubility and can influence its pharmacokinetic properties. This compound may exhibit specific interactions with biological targets, making it of interest in drug development. Its molecular structure suggests potential applications in fields such as organic synthesis, pharmaceuticals, and materials science. Additionally, the compound's CAS number, 878427-52-2, allows for easy identification and reference in chemical databases. Overall, the characteristics of this compound make it a subject of interest for further research and exploration in various scientific domains.

Formula: C₈H₁₁NO₄S

InChI: InChI=1/C8H11NO4S/c1-9(14(2,11)12)5-7-3-4-8(6-10)13-7/h3-4,6H,5H2,1-2H3

SMILES: CN(Cc1ccc(C=O)o1)S(=O)(=O)C

Synonyms:

• methanesulfonamide, N-[(5-formyl-2-furanyl)methyl]-N-methyl-
• N-[(5-Formyl-2-furyl)methyl]-N-methylmethanesulfonamide

N-((5-Formylfuran-2-yl)methyl)-N-methylmethanesulfonamide

CAS: 878427-52-2

N-((5-Formylfuran-2-yl)methyl)-N-methylmethanesulfonamide

Purity: 95%

Molecular weight: 217.25g/mol

Ref: 54-OR1064511

N-(5-Formyl-furan-2-ylmethyl)-N-methyl-methanesulfonamide

CAS: 878427-52-2

Formula: C₈H₁₁NO₄S

Purity: 95.0%

Molecular weight: 217.24

Ref: 10-F059792