CAS 87843-30-9

1H-Indole, 3-(ethylsulfinyl)-

Description:

1H-Indole, 3-(ethylsulfinyl)-, with the CAS number 87843-30-9, is a chemical compound that features an indole core, which is a bicyclic structure composed of a benzene ring fused to a pyrrole ring. This compound is characterized by the presence of an ethylsulfinyl group at the 3-position of the indole structure, which contributes to its unique chemical properties. The sulfinyl group typically enhances the compound's reactivity and may influence its biological activity. 1H-Indole derivatives are known for their diverse applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The compound may exhibit various biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in medicinal chemistry. Additionally, its solubility and stability can vary based on environmental conditions, such as pH and temperature. Overall, 1H-Indole, 3-(ethylsulfinyl)- represents a significant class of compounds with potential utility in various scientific fields.

Formula: C₁₀H₁₁NOS

InChI: InChI=1S/C10H11NOS/c1-2-13(12)10-7-11-9-6-4-3-5-8(9)10/h3-7,11H,2H2,1H3

InChI key: WANYAUPDHBQJNK-UHFFFAOYSA-N

SMILES: CCS(=O)C1=CNC2=CC=CC=C21