CAS 878437-17-3

4-(3-furan-2-yl-1,2,4-oxadiazol-5-yl)butanoic acid

Description:

4-(3-Furan-2-yl-1,2,4-oxadiazol-5-yl)butanoic acid is a chemical compound characterized by its unique structure, which includes a furan ring and an oxadiazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The oxadiazole ring contributes to its potential biological activity, as compounds containing this heterocyclic structure are often investigated for their pharmacological properties. The furan ring adds to the compound's aromatic character, potentially influencing its reactivity and interaction with biological targets. Additionally, the butanoic acid chain provides a hydrophobic segment that may enhance membrane permeability. Overall, this compound's characteristics make it of interest in medicinal chemistry and materials science, where its unique structural features could lead to novel applications.

Formula: C₁₀H₁₀N₂O₄

InChI: InChI=1/C10H10N2O4/c13-9(14)5-1-4-8-11-10(12-16-8)7-3-2-6-15-7/h2-3,6H,1,4-5H2,(H,13,14)

SMILES: C(Cc1nc(c2ccco2)no1)CC(=O)O

Synonyms:

• 1,2,4-Oxadiazole-5-Butanoic Acid, 3-(2-Furanyl)-
• 4-[3-(2-Furyl)-1,2,4-oxadiazol-5-yl]butanoic acid

4-(3-Furan-2-yl-[1,2,4]oxadiazol-5-yl)-butyric acid

CAS: 878437-17-3

Formula: C₁₀H₁₀N₂O₄

Purity: 95.0%

Molecular weight: 222.2

Ref: 10-F059862