CymitQuimica logo

CAS 87844-84-6

:

5-[[4-[[2-(1-Methylethoxy)ethoxy]methyl]phenoxy]methyl]-3-(1-methylethyl)-2-oxazolidinone

Description:
The chemical substance known as 5-[[4-[[2-(1-Methylethoxy)ethoxy]methyl]phenoxy]methyl]-3-(1-methylethyl)-2-oxazolidinone, with the CAS number 87844-84-6, is characterized by its complex molecular structure, which includes an oxazolidinone ring, phenolic groups, and ether functionalities. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents and potential stability under various conditions. Its structure suggests that it may have applications in pharmaceuticals or as a chemical intermediate, particularly due to the presence of the oxazolidinone moiety, which is known for its biological activity. The presence of alkyl ether groups may enhance its lipophilicity, influencing its interaction with biological membranes. Additionally, the compound's specific stereochemistry and functional groups could impart unique reactivity and binding characteristics, making it of interest in medicinal chemistry and materials science. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C19H29NO5
InChI:InChI=1S/C19H29NO5/c1-14(2)20-11-18(25-19(20)21)13-24-17-7-5-16(6-8-17)12-22-9-10-23-15(3)4/h5-8,14-15,18H,9-13H2,1-4H3
InChI key:InChIKey=MRVDGKFQFYHDHX-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(COCCOC(C)C)C=C1)C2CN(C(C)C)C(=O)O2
Synonyms:
  • 2-Oxazolidinone, 5-[[4-[[2-(1-methylethoxy)ethoxy]methyl]phenoxy]methyl]-3-(1-methylethyl)-
  • 5-[[4-[[2-(1-Methylethoxy)ethoxy]methyl]phenoxy]methyl]-3-(1-methylethyl)-2-oxazolidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.