CAS 878441-20-4

2-Chloro-1-(2,3-dihydro-2-methyl-5-benzofuranyl)ethanone

Description:

2-Chloro-1-(2,3-dihydro-2-methyl-5-benzofuranyl)ethanone is an organic compound characterized by its unique structure, which includes a chloro group and a benzofuran moiety. This compound features a chloro substituent on an ethanone backbone, contributing to its reactivity and potential applications in organic synthesis. The presence of the benzofuran ring, which is a fused bicyclic structure, imparts specific chemical properties, including potential biological activity. The compound is likely to exhibit moderate to low solubility in water, typical of many organic compounds with aromatic structures, while being more soluble in organic solvents. Its molecular structure suggests potential uses in pharmaceuticals or agrochemicals, where the benzofuran component may enhance biological interactions. Additionally, the chloro group can serve as a site for further chemical modifications, making it a versatile intermediate in synthetic chemistry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns.

Formula: C₁₁H₁₁ClO₂

InChI: InChI=1S/C11H11ClO2/c1-7-4-9-5-8(10(13)6-12)2-3-11(9)14-7/h2-3,5,7H,4,6H2,1H3

InChI key: InChIKey=WORVCWBAQGVIQH-UHFFFAOYSA-N

SMILES: C(CCl)(=O)C=1C=C2C(OC(C)C2)=CC1

Synonyms:

• 2-Chloro-1-(2,3-dihydro-2-methyl-5-benzofuranyl)ethanone
• Ethanone, 2-chloro-1-(2,3-dihydro-2-methyl-5-benzofuranyl)-