CAS 878441-21-5

1-[4-(4-Amino-2-chlorophenyl)-1-piperazinyl]-2,2-dimethyl-1-propanone

Description:

1-[4-(4-Amino-2-chlorophenyl)-1-piperazinyl]-2,2-dimethyl-1-propanone, identified by its CAS number 878441-21-5, is a chemical compound that features a piperazine ring, which is a common structural motif in many pharmaceuticals due to its ability to interact with various biological targets. This compound contains an amino group and a chlorophenyl moiety, contributing to its potential biological activity. The presence of the dimethylpropanone group suggests it may exhibit properties related to ketones, such as reactivity in condensation reactions. Its structural complexity indicates that it may have specific interactions with receptors or enzymes, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity would depend on its functional groups and overall molecular structure. As with many compounds containing nitrogen and halogens, it may also exhibit unique pharmacokinetic properties. Safety and handling considerations would be essential, as with any chemical substance, particularly those with potential biological activity.

Formula: C₁₅H₂₂ClN₃O

InChI: InChI=1S/C15H22ClN3O/c1-15(2,3)14(20)19-8-6-18(7-9-19)13-5-4-11(17)10-12(13)16/h4-5,10H,6-9,17H2,1-3H3

InChI key: InChIKey=GQTQTNXSDHBNKX-UHFFFAOYSA-N

SMILES: ClC1=C(N2CCN(C(C(C)(C)C)=O)CC2)C=CC(N)=C1

Synonyms:

• 1-[4-(4-Amino-2-chlorophenyl)-1-piperazinyl]-2,2-dimethyl-1-propanone
• Piperazine, 1-(4-amino-2-chlorophenyl)-4-(2,2-dimethyl-1-oxopropyl)-
• 1-Propanone, 1-[4-(4-amino-2-chlorophenyl)-1-piperazinyl]-2,2-dimethyl-