CAS 878441-49-7

2,5,7-Trimethyl[1,2,4]triazolo[1,5-a]pyrimidine-6-propanoic acid

Description:

2,5,7-Trimethyl[1,2,4]triazolo[1,5-a]pyrimidine-6-propanoic acid is a chemical compound characterized by its unique triazole and pyrimidine ring structures, which contribute to its potential biological activity. This compound features a propanoic acid functional group, which enhances its solubility and reactivity. The presence of three methyl groups at the 2, 5, and 7 positions of the triazole ring can influence its steric and electronic properties, potentially affecting its interaction with biological targets. The compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its CAS number, 878441-49-7, serves as a unique identifier for regulatory and research purposes. As with many heterocyclic compounds, the specific characteristics, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. Further studies are often required to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₁H₁₄N₄O₂

InChI: InChI=1S/C11H14N4O2/c1-6-9(4-5-10(16)17)7(2)15-11(12-6)13-8(3)14-15/h4-5H2,1-3H3,(H,16,17)

InChI key: InChIKey=MKEJYGMTOSXNLM-UHFFFAOYSA-N

SMILES: CC=1N2C(N=C(C)C1CCC(O)=O)=NC(C)=N2

Synonyms:

• 2,5,7-Trimethyl[1,2,4]triazolo[1,5-a]pyrimidine-6-propanoic acid
• [1,2,4]Triazolo[1,5-a]pyrimidine-6-propanoic acid, 2,5,7-trimethyl-