CAS 87848-96-2
:2-Bromo-6-[2-(4-methylphenyl)-1,3-dioxolan-2-yl]pyridine
Description:
2-Bromo-6-[2-(4-methylphenyl)-1,3-dioxolan-2-yl]pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and a dioxolane moiety. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The dioxolane group contributes to the compound's stability and solubility in organic solvents, while the 4-methylphenyl substituent enhances its hydrophobic characteristics. This compound may exhibit interesting biological activities due to its structural features, which can influence its interaction with biological targets. Additionally, its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific interactions and the environment in which it is studied. Overall, 2-Bromo-6-[2-(4-methylphenyl)-1,3-dioxolan-2-yl]pyridine represents a versatile structure with potential implications in various fields of chemistry and pharmacology.
Formula:C15H14BrNO2
InChI:InChI=1/C15H14BrNO2/c1-11-5-7-12(8-6-11)15(18-9-10-19-15)13-3-2-4-14(16)17-13/h2-8H,9-10H2,1H3
InChI key:InChIKey=WVNVMLQIFKCIQC-UHFFFAOYSA-N
SMILES:BrC1=NC(C2(OCCO2)C3=CC=C(C)C=C3)=CC=C1
Synonyms:- 2-Bromo-6-(2-(p-tolyl)-1,3-dioxolan-2-yl)pyridine
- 2-bromo-6-[2-(4-methylphenyl)-1,3-dioxolan-2-yl]pyridine
- Pyridine, 2-bromo-6-[2-(4-methylphenyl)-1,3-dioxolan-2-yl]-
- 2-Bromo-6-[2-(p-tolyl)-1,3-dioxolan-2-yl]pyridine
- 2-Bromo-6-[2-(4-methylphenyl)-1,3-dioxolan-2-yl]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
