CAS 87849-05-6
:2-Propenoic acid, 3-[6-[1-hydroxy-1-(4-methylphenyl)-3-(1-pyrrolidinyl)propyl]-2-pyridinyl]-, methyl ester, (E)-
Description:
The chemical substance known as "2-Propenoic acid, 3-[6-[1-hydroxy-1-(4-methylphenyl)-3-(1-pyrrolidinyl)propyl]-2-pyridinyl]-, methyl ester, (E)-" with CAS number 87849-05-6 is a complex organic compound characterized by its structure, which includes a propenoic acid moiety and various functional groups. This compound features a methyl ester group, indicating it is an ester derivative of acrylic acid. The presence of a pyridine ring and a pyrrolidine moiety suggests potential biological activity, as these structures are often found in pharmaceuticals and biologically active compounds. The (E)- configuration indicates that the double bond in the propenoic acid part of the molecule has a specific geometric arrangement, which can influence its reactivity and interactions. Additionally, the presence of a hydroxy group and a substituted phenyl group contributes to its polarity and solubility characteristics. Overall, this compound may exhibit interesting chemical properties and potential applications in medicinal chemistry or materials science, although specific biological or physical properties would require further investigation.
Formula:C23H28N2O3
InChI:InChI=1/C23H28N2O3/c1-18-8-10-19(11-9-18)23(27,14-17-25-15-3-4-16-25)21-7-5-6-20(24-21)12-13-22(26)28-2/h5-13,27H,3-4,14-17H2,1-2H3/b13-12+
InChI key:InChIKey=ZRPSDVVHVWUPEC-OUKQBFOZNA-N
SMILES:C(CCN1CCCC1)(O)(C=2N=C(/C=C/C(OC)=O)C=CC2)C3=CC=C(C)C=C3
Synonyms:- methyl (2E)-3-{6-[1-hydroxy-1-(4-methylphenyl)-3-pyrrolidin-1-ylpropyl]pyridin-2-yl}prop-2-enoate
- 2-Propenoic acid, 3-[6-[1-hydroxy-1-(4-methylphenyl)-3-(1-pyrrolidinyl)propyl]-2-pyridinyl]-, methyl ester, (E)-
- Methyl (E)-3-(6-(1-hydroxy-1-(4-methylphenyl)-3-(1-pyrrolidinyl)propyl)-2-pyridyl)acrylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propenoic acid,3-[6-[1-hydroxy-1-(4-methylphenyl)-3-(1-pyrrolidinyl)propyl]-2-pyridinyl]-,methyl ester, (E)- (9CI)
CAS:Formula:C23H28N2O3Molecular weight:380.48
