CAS 87853-68-7

Ethyl 2-bromo-4-methoxy-3-pyridinecarboxylate

Description:

Ethyl 2-bromo-4-methoxy-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and a methoxy group at the 4-position of the pyridine ring contributes to its reactivity and potential applications in organic synthesis. The ethyl ester functional group enhances its solubility in organic solvents, making it useful in various chemical reactions. This compound is typically used in medicinal chemistry and as an intermediate in the synthesis of other complex molecules. Its structure suggests potential biological activity, which can be explored in pharmacological studies. The compound is generally handled with standard safety precautions due to the presence of the bromine atom, which can be hazardous. Overall, Ethyl 2-bromo-4-methoxy-3-pyridinecarboxylate is a versatile building block in organic synthesis with applications in drug development and chemical research.

Formula: C₉H₁₀BrNO₃

InChI: InChI=1S/C9H10BrNO3/c1-3-14-9(12)7-6(13-2)4-5-11-8(7)10/h4-5H,3H2,1-2H3

InChI key: InChIKey=ILXPLTSBQHGCJZ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(OC)=CC=NC1Br

Synonyms:

• 3-Pyridinecarboxylic acid, 2-bromo-4-methoxy-, ethyl ester
• Ethyl 2-bromo-4-methoxy-3-pyridinecarboxylate