CymitQuimica logo

CAS 87853-82-5

:

Ethyl 2-cyano-3-hydroxy-2-butenoate

Description:
Ethyl 2-cyano-3-hydroxy-2-butenoate, with the CAS number 87853-82-5, is an organic compound characterized by its unique functional groups, including a cyano group (-CN), a hydroxyl group (-OH), and an ester group (-COOEt). This compound typically appears as a colorless to pale yellow liquid and is soluble in polar organic solvents. It is known for its reactivity, particularly in organic synthesis, where it can participate in various chemical reactions such as nucleophilic additions and condensation reactions. The presence of the cyano group imparts significant polarity, enhancing its ability to engage in electrophilic and nucleophilic reactions. Additionally, the hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its interactions with other molecules. Ethyl 2-cyano-3-hydroxy-2-butenoate is often utilized in the synthesis of more complex organic molecules and may have applications in pharmaceuticals and agrochemicals due to its versatile reactivity. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C7H9NO3
InChI:InChI=1S/C7H9NO3/c1-3-11-7(10)6(4-8)5(2)9/h9H,3H2,1-2H3
InChI key:InChIKey=ZCGIXZHJMNCSDQ-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(=C(C)O)C#N
Synonyms:
  • Ethyl 2-cyano-3-hydroxy-2-butenoate
  • 2-Butenoic acid, 2-cyano-3-hydroxy-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.