CAS 878572-17-9
:4-Fluoro-3-nitro-5-(trifluoromethyl)benzoic acid
Description:
4-Fluoro-3-nitro-5-(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of multiple functional groups that influence its chemical properties. The compound features a benzoic acid backbone with a trifluoromethyl group and a nitro group, which contribute to its reactivity and polarity. The fluorine atoms enhance the compound's electronegativity, potentially affecting its solubility in various solvents and its interaction with biological systems. This substance is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its unique structure makes it of interest in various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate in the synthesis of more complex molecules. Additionally, the presence of both electron-withdrawing groups (the nitro and trifluoromethyl groups) can significantly influence its acidity and reactivity in electrophilic aromatic substitution reactions. Overall, 4-Fluoro-3-nitro-5-(trifluoromethyl)benzoic acid is a versatile compound with potential applications in chemical synthesis and research.
Formula:C8H3F4NO4
InChI:InChI=1/C8H3F4NO4/c9-6-4(8(10,11)12)1-3(7(14)15)2-5(6)13(16)17/h1-2H,(H,14,15)
SMILES:c1c(cc(c(c1C(F)(F)F)F)N(=O)=O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Fluoro-3-nitro-5-(trifluoromethyl)benzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H3F4NO4Purity:97%Color and Shape:Powder, White to creamMolecular weight:253.114-Fluoro-3-nitro-5-(trifluoromethyl)benzoic acid
CAS:Formula:C8H3F4NO4Purity:97%Color and Shape:SolidMolecular weight:253.10734-Fluoro-3-nitro-5-(trifluoromethyl)benzoic acid
CAS:4-Fluoro-3-nitro-5-(trifluoromethyl)benzoic acidPurity:97%Molecular weight:253.11g/mol4-Fluoro-3-nitro-5-(trifluoromethyl)benzoic acid
CAS:Formula:C8H3F4NO4Purity:97%Color and Shape:SolidMolecular weight:253.1094-Fluoro-3-nitro-5-(trifluoromethyl)benzoic Acid
CAS:Controlled ProductApplications 4-FLUORO-3-NITRO-5-(TRIFLUOROMETHYL)BENZOIC ACID (cas# 878572-17-9) is a useful research chemical.
Formula:C8H3F4NO4Color and Shape:NeatMolecular weight:253.11




