CymitQuimica logo

CAS 87861-87-8

:

N''-(cyclohexylmethylidene)-N-hydroxycarbonohydrazonic diamide 4-methylbenzenesulfonate (1:1)

Description:
N''-(cyclohexylmethylidene)-N-hydroxycarbonohydrazonic diamide 4-methylbenzenesulfonate (1:1), with the CAS number 87861-87-8, is a chemical compound that features a hydrazone structure, characterized by the presence of a hydrazone functional group (-C=N-NH-). This compound is typically used in various chemical applications, including as a reagent in organic synthesis and potentially in pharmaceutical formulations. Its sulfonate component, derived from 4-methylbenzenesulfonic acid, enhances its solubility in polar solvents, making it useful in diverse chemical environments. The cyclohexylmethylidene moiety contributes to its steric properties, which can influence its reactivity and interaction with other molecules. The presence of the hydroxy group may also impart specific chemical reactivity, such as the ability to form hydrogen bonds. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and materials science, although specific biological activities and safety profiles would require further investigation.
Formula:C15H24N4O4S
InChI:InChI=1/C8H16N4O.C7H8O3S/c9-8(12-13)11-10-6-7-4-2-1-3-5-7;1-6-2-4-7(5-3-6)11(8,9)10/h6-7,13H,1-5H2,(H3,9,11,12);2-5H,1H3,(H,8,9,10)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.