CAS 87862-30-4
:Guanidine, [2-(3-iodophenyl)ethyl]-, sulfate (2:1)
Description:
Guanidine, [2-(3-iodophenyl)ethyl]-, sulfate (2:1) is a chemical compound characterized by its guanidine core, which is a strong base and often used in various chemical applications. The presence of the 3-iodophenyl group indicates that the compound has a phenyl ring substituted with an iodine atom, which can influence its reactivity and biological activity. The sulfate (2:1) designation suggests that the compound forms a salt with sulfate ions, indicating its potential solubility in water and its ionic nature. This compound may exhibit properties such as antimicrobial activity or serve as a precursor in organic synthesis. Its structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. As with many guanidine derivatives, it may also participate in hydrogen bonding due to the presence of nitrogen atoms, which can affect its physical properties and reactivity. Safety data should be consulted for handling, as compounds with halogen substituents can have specific hazards associated with them.
Formula:C9H12IN3H2O4S
InChI:InChI=1S/C9H12IN3.H2O4S/c10-8-3-1-2-7(6-8)4-5-13-9(11)12;1-5(2,3)4/h1-3,6H,4-5H2,(H4,11,12,13);(H2,1,2,3,4)
InChI key:InChIKey=KSOYKLUOBXHYOY-UHFFFAOYSA-N
SMILES:C(CNC(=N)N)C1=CC(I)=CC=C1.S(=O)(=O)(O)O
Synonyms:- Guanidine, [2-(3-iodophenyl)ethyl]-, sulfate (2:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Guanidine, [2-(3-iodophenyl)ethyl]-, sulfate (2:1)
CAS:Formula:C18H26I2N6O4SMolecular weight:676.3108
