CAS 87864-14-0
:2-Chloro-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide
Description:
2-Chloro-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide, with the CAS number 87864-14-0, is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro group and a diethylamino group, contributing to its potential biological activity. The presence of the carboxamide functional group suggests it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and reactivity. The diethylamino moiety may enhance its lipophilicity, potentially affecting its pharmacokinetics and interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, possibly as an antimicrobial or anticancer agent. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C16H20ClN3O
InChI:InChI=1/C16H20ClN3O/c1-3-20(4-2)10-9-18-16(21)13-11-15(17)19-14-8-6-5-7-12(13)14/h5-8,11H,3-4,9-10H2,1-2H3,(H,18,21)
SMILES:CCN(CC)CCN=C(c1cc(Cl)nc2ccccc12)O
Synonyms:- 2-Chloro-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide
- 4-quinolinecarboxamide, 2-chloro-N-[2-(diethylamino)ethyl]-
- 2-Chloro-N'-[2-(diethylamino)ethyl]-4-quinolinecarboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
4-Quinolinecarboxamide, 2-chloro-N-[2-(diethylamino)ethyl]-
CAS:Formula:C16H20ClN3OPurity:98%Color and Shape:SolidMolecular weight:305.80252-Chloro-N-(2-(diethylamino)ethyl)quinoline-4-carboxamide
CAS:2-Chloro-N-(2-(diethylamino)ethyl)quinoline-4-carboxamidePurity:98%Molecular weight:305.80g/molCinchocaine EP Impurity A
CAS:Formula:C16H20ClN3OColor and Shape:Off-White SolidMolecular weight:305.812-Chloro-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide
CAS:Controlled ProductFormula:C16H20ClN3OColor and Shape:NeatMolecular weight:305.802-Chloro-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide
CAS:<p>Applications Intermediate in the preparation of Dibucaine.<br></p>Formula:C16H20ClN3OColor and Shape:NeatMolecular weight:305.802-Chloro-N-(2-(diethylamino)ethyl)quinoline-4-carboxamide
CAS:Formula:C16H20ClN3OPurity:98%Molecular weight:305.812-Chloro-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide
CAS:<p>2-Chloro-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide is a carboxamide analog of dibucaine. It is synthesized from chloroacetyl chloride and isatin in the presence of sodium hydroxide. The synthesis has been scaled to an industrial level. 2-Chloro-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide has been shown to have analgesic properties, similar to those of dibucaine. Radiolysis of this compound gives a carboxylic acid and a heterocyclic ring product.</p>Formula:C16H20ClN3OPurity:95%MinColor and Shape:PowderMolecular weight:305.8 g/mol









