CAS 878657-12-6

2,5,6-Trimethyl-4-oxothieno[2,3-d]pyrimidine-3(4H)-acetic acid

Description:

2,5,6-Trimethyl-4-oxothieno[2,3-d]pyrimidine-3(4H)-acetic acid is a heterocyclic compound characterized by its unique thieno-pyrimidine structure, which incorporates both sulfur and nitrogen in its ring system. This compound features a ketone functional group and an acetic acid moiety, contributing to its potential reactivity and solubility in various solvents. The presence of multiple methyl groups enhances its hydrophobic characteristics, which may influence its biological activity and interaction with other molecules. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the specific arrangement of substituents can affect its electronic properties, stability, and overall reactivity. As with many heterocycles, the compound may exhibit interesting properties such as fluorescence or specific binding affinities, making it a subject of interest for further research in organic synthesis and drug development.

Formula: C₁₁H₁₂N₂O₃S

InChI: InChI=1S/C11H12N2O3S/c1-5-6(2)17-10-9(5)11(16)13(4-8(14)15)7(3)12-10/h4H2,1-3H3,(H,14,15)

InChI key: InChIKey=VGPMSABUFXSOTD-UHFFFAOYSA-N

SMILES: O=C1C2=C(N=C(C)N1CC(O)=O)SC(C)=C2C

Synonyms:

• Thieno[2,3-d]pyrimidine-3(4H)-acetic acid, 2,5,6-trimethyl-4-oxo-
• 2,5,6-Trimethyl-4-oxothieno[2,3-d]pyrimidine-3(4H)-acetic acid