CAS 878668-04-3
:2-chloro-N-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)acetamide
Description:
2-Chloro-N-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)acetamide is a chemical compound characterized by its unique structural features, which include a chloro group and a thiadiazole ring. The presence of the cyclobutyl group contributes to its three-dimensional structure, potentially influencing its biological activity and interactions. This compound is likely to exhibit moderate to high polarity due to the presence of the acetamide functional group, which can engage in hydrogen bonding. The thiadiazole moiety is known for its diverse biological activities, including antimicrobial and antifungal properties, making this compound of interest in pharmaceutical research. Additionally, the chloro substituent may enhance its reactivity and solubility in organic solvents. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-chloro-N-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)acetamide represents a class of compounds that may have potential applications in medicinal chemistry and agrochemicals.
Formula:C8H10ClN3OS
InChI:InChI=1/C8H10ClN3OS/c9-4-6(13)10-8-12-11-7(14-8)5-2-1-3-5/h5H,1-4H2,(H,10,12,13)
SMILES:C1CC(C1)c1nnc(N=C(CCl)O)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.