CAS 878669-96-6
:6-methyl-1-(1-methylethyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine
Description:
6-Methyl-1-(1-methylethyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine is a complex organic compound characterized by its unique bicyclic structure, which incorporates both a tetrahydropyrrole and a pyrazine moiety. This compound features a methyl group and an isopropyl group, contributing to its steric and electronic properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of nitrogen atoms in its structure suggests potential basicity and reactivity, which may influence its interactions in biological systems or chemical reactions. Its molecular structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's CAS number, 878669-96-6, allows for precise identification and retrieval of information in chemical databases. As with many organic compounds, its solubility, stability, and reactivity can vary significantly based on environmental conditions such as temperature and pH. Overall, this compound exemplifies the complexity and diversity found in organic chemistry.
Formula:C11H18N2
InChI:InChI=1/C11H18N2/c1-8(2)11-10-5-4-9(3)13(10)7-6-12-11/h4-5,8,11-12H,6-7H2,1-3H3
SMILES:CC(C)C1c2ccc(C)n2CCN1
Synonyms:- 6-Methyl-1-(Propan-2-Yl)-1,2,3,4-Tetrahydropyrrolo[1,2-A]Pyrazine
- Pyrrolo[1,2-A]Pyrazine, 1,2,3,4-Tetrahydro-6-Methyl-1-(1-Methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.