CAS 87870-32-4

1-Propen-1-amine, N-(2,3-dihydro-4H-1-benzopyran-4-ylidene)-, (E,Z)-

Description:

1-Propen-1-amine, N-(2,3-dihydro-4H-1-benzopyran-4-ylidene)-, (E,Z)-, with CAS number 87870-32-4, is an organic compound characterized by its dual functional groups: an amine and an alkene. The presence of the propenyl group indicates that it has unsaturation, which can contribute to its reactivity in various chemical reactions, such as polymerization or addition reactions. The benzopyran moiety suggests that the compound may exhibit aromatic characteristics, potentially influencing its stability and interaction with other molecules. The (E,Z) notation indicates that the compound exists in two geometric isomers, which can have different physical and chemical properties. This compound may be of interest in medicinal chemistry or materials science due to its structural features, which could impart specific biological activities or facilitate the formation of polymers. Its solubility, boiling point, and other physical properties would depend on the specific interactions of the functional groups and the overall molecular structure.

Formula: C₁₂H₁₃NO

InChI: InChI=1S/C12H13NO/c1-2-8-13-11-7-9-14-12-6-4-3-5-10(11)12/h2-6,8H,7,9H2,1H3/b8-2+,13-11?

InChI key: YNCIGRSDIGGPQD-JFKNUJAPSA-N

SMILES: C/C=C/N=C1CCOC2=CC=CC=C12

1-Propen-1-amine, N-(2,3-dihydro-4H-1-benzopyran-4-ylidene)-, (E,Z)-

CAS: 87870-32-4

Formula: C₁₂H₁₃NO

Molecular weight: 187.2377

Ref: IN-DA004EDK