CAS 87872-63-7

2-Butenoic acid, 2-[(3-methyl-1-oxobutyl)amino]-, iodomethyl ester, (Z)-

Description:

2-Butenoic acid, 2-[(3-methyl-1-oxobutyl)amino]-, iodomethyl ester, (Z)- is a chemical compound characterized by its unique structure, which includes a butenoic acid backbone with an amino group and an iodomethyl ester functional group. The (Z)- configuration indicates that the substituents around the double bond are on the same side, which can influence its reactivity and properties. This compound is likely to exhibit both acidic and basic characteristics due to the presence of the carboxylic acid and amino groups, respectively. It may participate in various chemical reactions, including esterification and nucleophilic substitution, owing to the presence of the iodomethyl group. The compound's molecular structure suggests potential applications in organic synthesis, pharmaceuticals, or agrochemicals. Additionally, its solubility and stability can be influenced by the presence of the ester and the overall polarity of the molecule. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₁₆INO₃

InChI: InChI=1S/C10H16INO3/c1-4-8(10(14)15-6-11)12-9(13)5-7(2)3/h4,7H,5-6H2,1-3H3,(H,12,13)/b8-4-

InChI key: APBGNCQPWFOLQK-YWEYNIOJSA-N

SMILES: C/C=C(/C(=O)OCI)\NC(=O)CC(C)C