CymitQuimica logo

CAS 87873-72-1

:

1-isocyanato-3-phenoxybenzene

Description:
1-Isocyanato-3-phenoxybenzene, with the CAS number 87873-72-1, is an organic compound characterized by the presence of both isocyanate and phenoxy functional groups. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly due to the isocyanate group, which can readily participate in nucleophilic addition reactions, making it useful in the synthesis of polyurethanes and other polymers. The phenoxy group contributes to its aromatic character, potentially influencing its solubility and stability in various solvents. Additionally, 1-isocyanato-3-phenoxybenzene may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its applications can extend to the fields of materials science and organic synthesis, where it serves as an intermediate in the production of more complex chemical structures. As with many isocyanates, it is important to consider its potential health hazards, including respiratory irritation and sensitization.
Formula:C13H9NO2
InChI:InChI=1/C13H9NO2/c15-10-14-11-5-4-8-13(9-11)16-12-6-2-1-3-7-12/h1-9H
SMILES:c1ccc(cc1)Oc1cccc(c1)N=C=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.