CymitQuimica logo

CAS 878733-38-1

:

1-ethyl-2-methyl-1H-indol-5-amine

Description:
1-Ethyl-2-methyl-1H-indol-5-amine, with the CAS number 878733-38-1, is an organic compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features an ethyl group and a methyl group attached to the indole nitrogen and carbon framework, respectively, which can influence its chemical reactivity and biological activity. Typically, indole derivatives are known for their diverse pharmacological properties, including potential applications in medicinal chemistry. The presence of the amine functional group suggests that this compound may engage in hydrogen bonding and participate in various chemical reactions, such as alkylation or acylation. Additionally, the specific arrangement of substituents on the indole ring can affect the compound's solubility, stability, and interaction with biological targets. Overall, 1-ethyl-2-methyl-1H-indol-5-amine represents a unique structure that may be of interest in research related to drug development and organic synthesis.
Formula:C11H14N2
InChI:InChI=1/C11H14N2/c1-3-13-8(2)6-9-7-10(12)4-5-11(9)13/h4-7H,3,12H2,1-2H3
SMILES:CCn1c(C)cc2cc(ccc12)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.