CymitQuimica logo

CAS 878743-46-5

:

6-Chloro-3-methylpyrido[3,4-d]pyrimidin-4(3H)-one

Description:
6-Chloro-3-methylpyrido[3,4-d]pyrimidin-4(3H)-one is a heterocyclic organic compound characterized by its fused pyridine and pyrimidine rings. This compound features a chlorine atom at the 6-position and a methyl group at the 3-position of the pyridine ring, contributing to its unique chemical properties. It typically exhibits moderate to high solubility in polar organic solvents, which is common for compounds containing nitrogen heterocycles. The presence of the chloro and methyl substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, this compound may exhibit biological activity, which is often explored in medicinal chemistry for potential therapeutic applications. Its molecular structure allows for interactions with biological targets, making it of interest in drug discovery. As with many heterocycles, the stability and reactivity of 6-Chloro-3-methylpyrido[3,4-d]pyrimidin-4(3H)-one can be influenced by environmental factors such as pH and temperature.
Formula:C8H6ClN3O
InChI:InChI=1/C8H6ClN3O/c1-12-4-11-6-3-10-7(9)2-5(6)8(12)13/h2-4H,1H3
SMILES:Cn1cnc2cnc(cc2c1=O)Cl
Synonyms:
  • pyrido[3,4-d]pyrimidin-4(3H)-one, 6-chloro-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.