CAS 878790-03-5
:1-ethyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride
Description:
1-Ethyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride is a chemical compound characterized by its tetrahydroisoquinoline structure, which is a bicyclic compound featuring a nitrogen atom within a saturated ring system. This specific compound is a hydrochloride salt, indicating that it is typically encountered in a stable, water-soluble form due to the presence of hydrochloric acid. The ethyl and dimethoxy substituents on the isoquinoline core contribute to its unique chemical properties, potentially influencing its biological activity and solubility. Compounds of this class are often studied for their pharmacological potential, including effects on the central nervous system. The presence of methoxy groups can enhance lipophilicity, which may affect the compound's ability to cross biological membranes. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature. Safety data and handling precautions should be consulted when working with this compound, as with any chemical substance.
Formula:C13H20ClNO2
InChI:InChI=1/C13H19NO2.ClH/c1-4-11-10-8-13(16-3)12(15-2)7-9(10)5-6-14-11;/h7-8,11,14H,4-6H2,1-3H3;1H
Synonyms:- 1-ETHYL-6,7-DIMETHOXY-1,2,3,4-TETRAHYDROISOQUINOLINE HYDROCHLORIDE
- 1-ethyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline hydroch...
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Ethyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride
CAS:Formula:C13H20ClNO2Molecular weight:257.7564
