CAS 87880-61-3
:3,3'-[propane-2,2-diylbis(benzene-4,1-diyloxy)]dianiline
Description:
3,3'-[Propane-2,2-diylbis(benzene-4,1-diyloxy)]dianiline, with the CAS number 87880-61-3, is an organic compound characterized by its complex structure that includes two aniline groups connected by a propane-2,2-diyl bridge and two benzene rings substituted with ether linkages. This compound typically exhibits properties such as high thermal stability and good solubility in organic solvents, making it suitable for various applications in materials science, particularly in the development of polymers and composites. The presence of multiple aromatic rings contributes to its rigidity and potential for π-π stacking interactions, which can enhance mechanical properties. Additionally, the aniline groups may impart reactivity, allowing for further functionalization or cross-linking in polymer matrices. Overall, this compound is of interest in fields such as organic electronics, coatings, and advanced materials due to its unique structural features and potential for tailored properties.
Formula:C27H26N2O2
InChI:InChI=1/C27H26N2O2/c1-27(2,19-9-13-23(14-10-19)30-25-7-3-5-21(28)17-25)20-11-15-24(16-12-20)31-26-8-4-6-22(29)18-26/h3-18H,28-29H2,1-2H3
SMILES:CC(C)(c1ccc(cc1)Oc1cccc(c1)N)c1ccc(cc1)Oc1cccc(c1)N
Synonyms:- 2,2'-Bis[4-(3-aminophenoxy)phenyl]propane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.