CymitQuimica logo

CAS 87883-20-3

:

5-Nitro-3-pyridinecarboxaldehyde

Description:
5-Nitro-3-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a nitro group (-NO2) and an aldehyde group (-CHO) attached to the pyridine ring, specifically at the 5 and 3 positions, respectively. The presence of the nitro group contributes to its electron-withdrawing properties, influencing its reactivity and potential applications in organic synthesis. The aldehyde functional group makes it a versatile intermediate in the synthesis of various chemical compounds, including pharmaceuticals and agrochemicals. 5-Nitro-3-pyridinecarboxaldehyde is typically a yellow to brown solid, and it is soluble in organic solvents. Its reactivity can be attributed to the electrophilic nature of the aldehyde group, allowing it to participate in condensation reactions and other transformations. Safety precautions should be observed when handling this compound, as nitro compounds can be hazardous. Overall, its unique structure and functional groups make it a valuable compound in chemical research and industrial applications.
Formula:C6H4N2O3
InChI:InChI=1S/C6H4N2O3/c9-4-5-1-6(8(10)11)3-7-2-5/h1-4H
InChI key:InChIKey=UJOOPEFUADGBNG-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C=O)C=NC1
Synonyms:
  • 5-Nitro-3-pyridinecarboxaldehyde
  • 3-Pyridinecarboxaldehyde, 5-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.