CAS 87884-41-1

2-Pyridinecarbonitrile, 6-(2-phenylethenyl)-

Description:

2-Pyridinecarbonitrile, 6-(2-phenylethenyl)-, also known by its CAS number 87884-41-1, is an organic compound characterized by its pyridine and nitrile functional groups. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and a carbonitrile group (-C≡N) that contributes to its reactivity and polarity. The presence of the 2-phenylethenyl substituent introduces an alkene functionality, enhancing its potential for various chemical reactions, including electrophilic additions and polymerization. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its aromatic nature. Its chemical properties make it of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the presence of both aromatic and aliphatic components in its structure may influence its biological activity and interactions with other molecules. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₄H₁₀N₂

InChI: InChI=1S/C14H10N2/c15-11-14-8-4-7-13(16-14)10-9-12-5-2-1-3-6-12/h1-10H

InChI key: MXYRHLHQIBBEKY-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)C=CC2=NC(=CC=C2)C#N

2-Pyridinecarbonitrile, 6-(2-phenylethenyl)-

CAS: 87884-41-1

Formula: C₁₄H₁₀N₂

Molecular weight: 206.2426

Ref: IN-DA004E78