CAS 87884-58-0

2H-Pyrrol-2-one, 5-butylidene-1,5-dihydro-1-methyl-, (Z)-

Description:

2H-Pyrrol-2-one, 5-butylidene-1,5-dihydro-1-methyl-, (Z)-, also known by its CAS number 87884-58-0, is a chemical compound characterized by its pyrrolone structure, which features a five-membered ring containing both nitrogen and carbon atoms. This compound exhibits a butylidene substituent at the 5-position and a methyl group at the 1-position, contributing to its unique properties. The (Z)- configuration indicates that the substituents around the double bond are on the same side, which can influence its reactivity and interactions with other molecules. Typically, compounds of this class may display biological activity, making them of interest in medicinal chemistry and organic synthesis. The presence of the butylidene group can enhance lipophilicity, potentially affecting solubility and permeability in biological systems. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.

Formula: C₉H₁₃NO

InChI: InChI=1S/C9H13NO/c1-3-4-5-8-6-7-9(11)10(8)2/h5-7H,3-4H2,1-2H3

InChI key: YIZRCHAJBMVSMZ-UHFFFAOYSA-N

SMILES: CCCC=C1C=CC(=O)N1C