CAS 87887-12-5
:1-[(2,2,6-Trimethylcyclohexyl)oxy]-2-pentanol
Description:
1-[(2,2,6-Trimethylcyclohexyl)oxy]-2-pentanol, identified by its CAS number 87887-12-5, is an organic compound characterized by its ether and alcohol functional groups. This substance features a pentanol backbone, which contributes to its solubility in polar solvents, while the bulky 2,2,6-trimethylcyclohexyl group enhances its hydrophobic properties. The presence of the ether linkage imparts unique reactivity and stability, making it useful in various applications, including as a solvent or intermediate in chemical synthesis. Its molecular structure suggests it may exhibit moderate volatility and a relatively low melting point, typical of similar organic compounds. Additionally, the compound's physical properties, such as boiling point and density, can be influenced by the steric hindrance introduced by the cyclohexyl group. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during use. Overall, this compound's unique structure positions it as a versatile chemical in industrial and research applications.
Formula:C14H28O2
InChI:InChI=1/C14H28O2/c1-5-7-12(15)10-16-13-11(2)8-6-9-14(13,3)4/h11-13,15H,5-10H2,1-4H3
InChI key:InChIKey=MVJUTJROMROTCV-UHFFFAOYSA-N
SMILES:O(CC(CCC)O)C1C(C)(C)CCCC1C
Synonyms:- 1-[(2,2,6-Trimethylcyclohexyl)oxy]-2-pentanol
- 1-((2,2,6-Trimethylcyclohexyl)oxy)pentan-2-ol
- 2-Pentanol, 1-[(2,2,6-trimethylcyclohexyl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
