CAS 87887-65-8

Piperazine, 1-(diphenylmethyl)-4-(1-naphthalenylmethyl)-, ethanedioate

Description:

Piperazine, 1-(diphenylmethyl)-4-(1-naphthalenylmethyl)-, ethanedioate, with the CAS number 87887-65-8, is a chemical compound that belongs to the class of piperazine derivatives. This substance typically exhibits a complex structure characterized by the presence of a piperazine ring, which is a six-membered heterocyclic compound containing two nitrogen atoms. The compound features diphenylmethyl and naphthalenylmethyl groups, contributing to its potential biological activity and interaction with various receptors. As an ethanedioate, it may form salts or complexes with acids, influencing its solubility and stability. The presence of aromatic groups suggests potential for π-π stacking interactions, which can affect its pharmacokinetic properties. Piperazine derivatives are often studied for their pharmacological applications, including anti-anxiety and antidepressant effects, as well as their roles in various therapeutic areas. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₂₈H₂₈N₂xC₂H₂O₄

InChI: InChI=1S/C28H28N2.C2H2O4/c1-3-11-24(12-4-1)28(25-13-5-2-6-14-25)30-20-18-29(19-21-30)22-26-16-9-15-23-10-7-8-17-27(23)26;3-1(4)2(5)6/h1-17,28H,18-22H2;(H,3,4)(H,5,6)

InChI key: RSIRESOFKIYFEH-UHFFFAOYSA-N

SMILES: C1CN(CCN1CC2=CC=CC3=CC=CC=C32)C(C4=CC=CC=C4)C5=CC=CC=C5.C(=O)(C(=O)O)O