CAS 878905-11-4
:tert-Butyl 2-(tert-butoxycarbonylamino)-6-(methylsulfonyloxy)hexanoate
Description:
Tert-Butyl 2-(tert-butoxycarbonylamino)-6-(methylsulfonyloxy)hexanoate is a chemical compound characterized by its complex structure, which includes a tert-butyl group, an amino group protected by a tert-butoxycarbonyl (Boc) moiety, and a methylsulfonyloxy group. This compound is typically used in organic synthesis and pharmaceutical applications due to its functional groups that allow for further chemical modifications. The presence of the tert-butyl group contributes to its hydrophobic characteristics, while the Boc group serves as a protective group for the amino functionality, facilitating selective reactions. The methylsulfonyloxy group enhances the compound's reactivity, making it useful in various synthetic pathways. Additionally, the hexanoate backbone provides a medium-length carbon chain, which can influence the compound's solubility and biological activity. Overall, this compound exemplifies the intricate design often found in synthetic organic chemistry, where specific functional groups are strategically incorporated to achieve desired reactivity and stability.
Formula:C16H31NO7S
InChI:InChI=1/C16H31NO7S/c1-15(2,3)23-13(18)12(17-14(19)24-16(4,5)6)10-8-9-11-22-25(7,20)21/h12H,8-11H2,1-7H3,(H,17,19)
SMILES:CC(C)(C)OC(=O)C(CCCCOS(=O)(=O)C)N=C(O)OC(C)(C)C
Synonyms:- norleucine, N-[(1,1-dimethylethoxy)carbonyl]-6-[(methylsulfonyl)oxy]-, 1,1-dimethylethyl ester
- tert-butyl N-(tert-butoxycarbonyl)-6-[(methylsulfonyl)oxy]norleucinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 2-((tert-butoxycarbonyl)amino)-6-((methylsulfonyl)oxy)hexanoate
CAS:Formula:C16H31NO7SMolecular weight:381.4848
