CAS 87891-60-9

7-hydroxy-3-phenoxy-4H-chromen-4-one

Description:

7-Hydroxy-3-phenoxy-4H-chromen-4-one, also known by its CAS number 87891-60-9, is a chemical compound belonging to the flavonoid class, specifically a type of chromone. This compound features a chromone backbone, characterized by a benzopyran structure, which is substituted at the 7-position with a hydroxyl group and at the 3-position with a phenoxy group. The presence of the hydroxyl group contributes to its potential antioxidant properties, while the phenoxy group may enhance its biological activity and solubility in organic solvents. This compound is of interest in various fields, including medicinal chemistry and natural product research, due to its potential pharmacological effects, such as anti-inflammatory and antimicrobial activities. Its structural features allow for various chemical modifications, which can lead to derivatives with enhanced biological properties. As with many flavonoids, it may also exhibit UV-absorbing properties, making it relevant in studies related to photoprotection and skin health.

Formula: C₁₅H₁₀O₄

InChI: InChI=1/C15H10O4/c16-10-6-7-12-13(8-10)18-9-14(15(12)17)19-11-4-2-1-3-5-11/h1-9,16H

SMILES: c1ccc(cc1)Oc1coc2cc(ccc2c1=O)O

Synonyms:

• 4H-1-benzopyran-4-one, 7-hydroxy-3-phenoxy-

7-Hydroxy-3-phenoxy-4H-chromen-4-one

CAS: 87891-60-9

Versatile small molecule scaffold

Formula: C₁₅H₁₀O₄

Purity: Min. 95%

Molecular weight: 254.24 g/mol

Ref: 3D-MDA89160