CymitQuimica logo

CAS 87893-54-7

:

Δ12-PGJ2

Description:
Δ12-PGJ2, or Delta-12-prostaglandin J2, is a naturally occurring prostaglandin derivative that plays a significant role in various biological processes. It is characterized by its unique structure, which includes a cyclopentane ring and multiple double bonds, contributing to its reactivity and biological activity. This compound is known for its anti-inflammatory properties and its ability to modulate cellular signaling pathways, particularly through the activation of peroxisome proliferator-activated receptor gamma (PPAR-γ). Δ12-PGJ2 is also involved in the regulation of apoptosis and has been studied for its potential therapeutic effects in conditions such as cancer and metabolic disorders. Its lipophilic nature allows it to easily cross cell membranes, facilitating its interaction with intracellular targets. Additionally, Δ12-PGJ2 can undergo various metabolic transformations, influencing its stability and activity in biological systems. Overall, this compound is a significant focus of research due to its diverse physiological effects and potential applications in medicine.
Formula:C20H30O4
InChI:InChI=1S/C20H30O4/c1-2-3-6-10-17(21)13-14-18-16(12-15-19(18)22)9-7-4-5-8-11-20(23)24/h4,7,12,14-17,21H,2-3,5-6,8-11,13H2,1H3,(H,23,24)/b7-4-,18-14+/t16-,17-/m0/s1
InChI key:InChIKey=TUXFWOHFPFBNEJ-GJGHEGAFSA-N
SMILES:C(\C[C@H](CCCCC)O)=C/1\[C@@H](C/C=C\CCCC(O)=O)C=CC1=O
Synonyms:
  • (5Z,12E,15S)-15-Hydroxy-11-oxoprosta-5,9,12-trien-1-oic acid
  • D12-Pgj2
  • D12-Prostaglandin J2
  • Prosta-5,9,12-trien-1-oic acid, 15-hydroxy-11-oxo-, (5Z,12E,15S)-
  • Δ<sup>12</sup>-PGJ<sub>2</sub>
  • Δ<sup>12</sup>-Prostaglandin J<sub>2</sub>
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.