CAS 87893-55-8
:15-Deoxy-Δ12,14-prostaglandin
Description:
15-Deoxy-Δ12,14-prostaglandin, identified by its CAS number 87893-55-8, is a naturally occurring prostaglandin derivative that plays a significant role in various physiological processes. This compound is characterized by its unique structure, which includes a cyclopentane ring and multiple functional groups, contributing to its biological activity. It is known for its involvement in regulating inflammation, vascular tone, and reproductive functions. The compound exhibits potent effects on smooth muscle contraction and can influence the synthesis of other bioactive lipids. Additionally, 15-Deoxy-Δ12,14-prostaglandin has been studied for its potential therapeutic applications, particularly in the context of cardiovascular health and reproductive medicine. Its stability and reactivity are influenced by the presence of double bonds and hydroxyl groups in its structure, making it a subject of interest in both pharmacological research and synthetic chemistry. Overall, this prostaglandin derivative is a key player in the complex network of lipid mediators that govern various biological responses.
Formula:C20H28O3
InChI:InChI=1S/C20H28O3/c1-2-3-4-5-6-10-13-18-17(15-16-19(18)21)12-9-7-8-11-14-20(22)23/h6-7,9-10,13,15-17H,2-5,8,11-12,14H2,1H3,(H,22,23)/b9-7-,10-6+,18-13+/t17-/m0/s1
InChI key:InChIKey=VHRUMKCAEVRUBK-GODQJPCRSA-N
SMILES:C(\C=C\CCCCC)=C/1\[C@@H](C/C=C\CCCC(O)=O)C=CC1=O
Synonyms:- (+)-15-Deoxy-Δ<sup>12,14</sup>-prostaglandin J<sub>2</sub>
- (5Z,12E,14E)-11-oxo-prosta-5,9,12,14-tetraen-1-oic acid
- 15-DPGJ<sub>2</sub>
- 15-Deoxy-Δ<sup>12,14</sup>-PGJ<sub>2</sub>
- 15-Deoxy-Δ<sup>12</sup>,<sup>14</sup>-prostaglandin
- 15-Deoxy-Δ<sup>12</sup>,<sup>14</sup>-prostaglandin J<sub>2</sub>
- Prosta-5,9,12,14-tetraen-1-oic acid, 11-oxo-, (5Z,12E,14E)-
- Δ<sup>12,14</sup>-15-Deoxy-PGJ<sub>2</sub>
- Δ<sup>12,14</sup>-15-Deoxyprostaglandin J<sub>2</sub>
- Δ<sup>12,14</sup>-PGJ 2
- 15-Deoxy-Δ12,14-PGJ2
- (5Z,12E,14E)-11-Oxoprosta-5,9,12,14-tetraen-1-oic acid
- Δ12,14-PGJ 2
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Prosta-5,9,12,14-tetraen-1-oicacid, 11-oxo-, (5Z,12E,14E)-
CAS:Formula:C20H28O3Purity:98%Molecular weight:316.434515-deoxy-Δ-12,14-Prostaglandin J2
CAS:15-deoxy-Δ-12,14-Prostaglandin J2 is a PPARγ agonist.Formula:C20H28O3Purity:98%Color and Shape:Neat OilMolecular weight:316.4315-Deoxy-δ12,14-Prostaglandin J2
CAS:Controlled ProductFormula:C20H28O3Color and Shape:NeatMolecular weight:316.43515-deoxy--12,14-Prostaglandin J2
CAS:15-deoxy--12,14-prostaglandin J2 (15d-PGJ2) is a prostaglandin that is produced by 3T3-L1 preadipocytes in response to various stimuli. 15d-PGJ2 has been shown to inhibit the production of inflammatory cytokines and may be an important modulator of inflammation. 15d-PGJ2 has also been shown to induce autophagy and apoptosis in cancer cells. This compound is cytotoxic at high concentrations, but not at low levels. The molecular docking analysis suggests that 15d-PGJ2 binds to the transcription factor NFATc1, which may account for its anti-inflammatory effects.
Formula:C20H28O3Purity:Min. 95%Molecular weight:316.44 g/molRef: 3D-MDA89355
Discontinued product



