CAS 87895-38-3

2-Cyclopenten-1-one, 3-(acetyloxy)-4-(2-methyl-2-propenyl)-

Description:

2-Cyclopenten-1-one, 3-(acetyloxy)-4-(2-methyl-2-propenyl)-, with the CAS number 87895-38-3, is an organic compound characterized by its unique cyclic structure and functional groups. It features a cyclopentene ring, which is a five-membered carbon ring containing a double bond, contributing to its reactivity and potential applications in organic synthesis. The presence of an acetyloxy group indicates that it has an ester functional group, which can influence its solubility and reactivity. Additionally, the 2-methyl-2-propenyl substituent introduces a branched alkene, enhancing its potential for further chemical transformations. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and natural product synthesis. Its properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, 2-Cyclopenten-1-one, 3-(acetyloxy)-4-(2-methyl-2-propenyl)- is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₁H₁₄O₃

InChI: InChI=1S/C11H14O3/c1-7(2)4-9-5-10(13)6-11(9)14-8(3)12/h6,9H,1,4-5H2,2-3H3

InChI key: XQUUPRSKSWCDEM-UHFFFAOYSA-N

SMILES: CC(=C)CC1CC(=O)C=C1OC(=O)C