CAS 878969-65-4

2,3-dihydro-1,4-benzodioxin-6-yl(3-iodophenyl)methanone

Description:

2,3-Dihydro-1,4-benzodioxin-6-yl(3-iodophenyl)methanone is a chemical compound characterized by its unique structure, which includes a benzodioxin moiety and an iodo-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential stability and reactivity due to the presence of the carbonyl group. The benzodioxin structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets through various mechanisms. The iodine atom in the phenyl group can enhance the compound's lipophilicity and may influence its biological activity, making it a candidate for further investigation in drug design. Additionally, the compound's molecular weight, solubility, and melting point would be important characteristics to consider for practical applications. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of iodine, which can pose health risks.

Formula: C₁₅H₁₁IO₃

InChI: InChI=1/C15H11IO3/c16-12-3-1-2-10(8-12)15(17)11-4-5-13-14(9-11)19-7-6-18-13/h1-5,8-9H,6-7H2

SMILES: c1cc(cc(c1)I)C(=O)c1ccc2c(c1)OCCO2

Synonyms:

• Methanone, (2,3-Dihydro-1,4-Benzodioxin-6-Yl)(3-Iodophenyl)-