CymitQuimica logo

CAS 87897-24-3

:

9,10-Anthracenedione, 2,6-bis[(4-ethylphenyl)thio]-1,4,5,8-tetrahydroxy-

Description:
9,10-Anthracenedione, 2,6-bis[(4-ethylphenyl)thio]-1,4,5,8-tetrahydroxy- is an organic compound characterized by its complex structure, which includes an anthracene backbone with multiple functional groups. This compound features two thioether groups attached to the anthracene core, enhancing its solubility and reactivity. The presence of hydroxyl groups contributes to its potential as a reducing agent and may influence its biological activity. Typically, compounds of this nature exhibit interesting photophysical properties, making them suitable for applications in organic electronics, such as organic light-emitting diodes (OLEDs) and solar cells. Additionally, the presence of ethylphenyl groups may impart specific electronic characteristics, affecting the compound's stability and interaction with other molecules. Due to its structural complexity, this compound may also exhibit unique interactions in biological systems, warranting further investigation into its potential therapeutic applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C30H24O6S2
InChI:InChI=1S/C30H24O6S2/c1-3-15-5-9-17(10-6-15)37-21-13-19(31)23-25(27(21)33)29(35)24-20(32)14-22(28(34)26(24)30(23)36)38-18-11-7-16(4-2)8-12-18/h5-14,31-34H,3-4H2,1-2H3
InChI key:ISQYCDXKZYWGPV-UHFFFAOYSA-N
SMILES:CCC1=CC=C(C=C1)SC2=C(C3=C(C(=C2)O)C(=O)C4=C(C3=O)C(=CC(=C4O)SC5=CC=C(C=C5)CC)O)O
Found 1 products.