CymitQuimica logo

CAS 879-12-9

:

1,2,3-Trimethylnaphthalene

Description:
1,2,3-Trimethylnaphthalene is an organic compound belonging to the naphthalene family, characterized by its polycyclic aromatic structure. It consists of a naphthalene core with three methyl groups attached at the 1, 2, and 3 positions. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature, and has a distinctive aromatic odor. It is relatively insoluble in water but soluble in organic solvents such as ethanol and ether. 1,2,3-Trimethylnaphthalene is known for its stability and resistance to oxidation, making it useful in various applications, including as a solvent and in the synthesis of other organic compounds. Its chemical properties include a relatively high boiling point and melting point compared to simpler hydrocarbons, reflecting its larger molecular size and complexity. Additionally, it is considered a potential environmental pollutant due to its persistence and bioaccumulation potential. Safety precautions should be taken when handling this compound, as it may pose health risks upon exposure.
Formula:C13H14
InChI:InChI=1/C13H14/c1-9-8-12-6-4-5-7-13(12)11(3)10(9)2/h4-8H,1-3H3
InChI key:InChIKey=RQHPYGROUIBUSW-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=C(C)C1C)C=CC=C2
Synonyms:
  • 1,2,3-Trimethylnaphthalene
  • Naphthalene, 1,2,3-trimethyl-
  • Naphthalene, 1,2,3-trimethyl-
  • Naphthalene, 2,3,4-trimethyl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.